C22H25FN4O3 — CID 108527539
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-morpholin-4-ylphenyl)-2-oxoacetamide (PubChem CID 108527539) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-morpholin-4-ylphenyl)-2-oxoacetamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-morpholin-4-ylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108527539 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-morpholin-4-ylphenyl)-2-oxoacetamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H25FN4O3/c23-17-5-1-3-7-19(17)25-9-11-27(12-10-25)22(29)21(28)24-18-6-2-4-8-20(18)26-13-15-30-16-14-26/h1-8H,9-16H2,(H,24,28) |
| InChIKey | CPFOFUANIIALBR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|