C18H20FN3O4S — CID 2594456
2-[(2-fluorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 2594456) has the molecular formula C18H20FN3O4S and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2594456 |
| Molecular Formula | C18H20FN3O4S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1F)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H20FN3O4S/c19-16-3-1-2-4-17(16)27(24,25)20-13-18(23)21-14-5-7-15(8-6-14)22-9-11-26-12-10-22/h1-8,20H,9-13H2,(H,21,23) |
| InChIKey | SBBGUWBXXPNMKW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|