C22H30N4O4S — CID 4846803
2-[4-(diethylsulfamoyl)anilino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4846803) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)anilino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)anilino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4846803 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)anilino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCC(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-3-26(4-2)31(28,29)21-11-7-18(8-12-21)23-17-22(27)24-19-5-9-20(10-6-19)25-13-15-30-16-14-25/h5-12,23H,3-4,13-17H2,1-2H3,(H,24,27) |
| InChIKey | TWDRWVNQUICCKI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|