C21H27N3O5 — CID 55362335
N-(4-morpholin-4-ylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 55362335) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 55362335 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | COc1cc(NCC(=O)Nc2ccc(N3CCOCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H27N3O5/c1-26-18-12-16(13-19(27-2)21(18)28-3)22-14-20(25)23-15-4-6-17(7-5-15)24-8-10-29-11-9-24/h4-7,12-13,22H,8-11,14H2,1-3H3,(H,23,25) |
| InChIKey | YIYPBEIFCTTZQL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|