C20H25N3O3 — CID 109009591
2-(3,4-dimethoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 109009591) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(3,4-dimethoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 109009591 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccc(N3CCCC3)cc2)cc1OC |
| InChI | InChI=1S/C20H25N3O3/c1-25-18-10-7-16(13-19(18)26-2)21-14-20(24)22-15-5-8-17(9-6-15)23-11-3-4-12-23/h5-10,13,21H,3-4,11-12,14H2,1-2H3,(H,22,24) |
| InChIKey | LVKMBFXRZARLME-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|