C26H29N3O3 — CID 60587672
2-[2-(2,6-dimethylphenoxy)anilino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 60587672) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenoxy)anilino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[2-(2,6-dimethylphenoxy)anilino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 60587672 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[2-(2,6-dimethylphenoxy)anilino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1Oc1ccccc1NCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-19-6-5-7-20(2)26(19)32-24-9-4-3-8-23(24)27-18-25(30)28-21-10-12-22(13-11-21)29-14-16-31-17-15-29/h3-13,27H,14-18H2,1-2H3,(H,28,30) |
| InChIKey | QGKRBKHLVBRMSF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|