C25H33N3O6 — CID 4850126
N-(2,4-dimorpholin-4-ylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 4850126) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4850126 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2ccc(N3CCOCC3)cc2N2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H33N3O6/c1-30-22-14-18(15-23(31-2)25(22)32-3)16-24(29)26-20-5-4-19(27-6-10-33-11-7-27)17-21(20)28-8-12-34-13-9-28/h4-5,14-15,17H,6-13,16H2,1-3H3,(H,26,29) |
| InChIKey | HRVGBVBFQMDYTQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |