C25H26N2O4 — CID 38748683
N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 38748683) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 38748683 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2ccccc2N2CCc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N2O4/c1-29-22-14-17(15-23(30-2)25(22)31-3)16-24(28)26-19-9-5-7-11-21(19)27-13-12-18-8-4-6-10-20(18)27/h4-11,14-15H,12-13,16H2,1-3H3,(H,26,28) |
| InChIKey | IMVJWKAIMWGQRG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |