C29H35N3O4 — CID 55647454
N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 55647454) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55647454 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2ccc(CN3CCN(Cc4ccccc4)CC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H35N3O4/c1-34-26-17-24(18-27(35-2)29(26)36-3)19-28(33)30-25-11-9-23(10-12-25)21-32-15-13-31(14-16-32)20-22-7-5-4-6-8-22/h4-12,17-18H,13-16,19-21H2,1-3H3,(H,30,33) |
| InChIKey | IUBMRCAKNJBOPJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |