C22H28N2O4 — CID 28806
2-(4-benzylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 28806) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 28806 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)CN2CCN(Cc3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H28N2O4/c1-26-20-13-18(14-21(27-2)22(20)28-3)19(25)16-24-11-9-23(10-12-24)15-17-7-5-4-6-8-17/h4-8,13-14H,9-12,15-16H2,1-3H3 |
| InChIKey | JWQMEGYQWJZJAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |