C21H28N4O4 — CID 112771327
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide (PubChem CID 112771327) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 112771327 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide |
| SMILES | Cc1noc(C)c1CC(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C21H28N4O4/c1-15-18(16(2)29-23-15)14-21(26)22-19-4-3-17(24-5-9-27-10-6-24)13-20(19)25-7-11-28-12-8-25/h3-4,13H,5-12,14H2,1-2H3,(H,22,26) |
| InChIKey | XQYDAWVYCFHUIR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |