C26H30N4O4 — CID 112808713
N-(2,4-dimorpholin-4-ylphenyl)-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetamide (PubChem CID 112808713) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 112808713 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetamide |
| SMILES | Cc1oc(-c2ccccc2)nc1CC(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C26H30N4O4/c1-19-23(28-26(34-19)20-5-3-2-4-6-20)18-25(31)27-22-8-7-21(29-9-13-32-14-10-29)17-24(22)30-11-15-33-16-12-30/h2-8,17H,9-16,18H2,1H3,(H,27,31) |
| InChIKey | NDPUIWMMMLPXTO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |