C25H28N4O4 — CID 4794943
N-(2,4-dimorpholin-4-ylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 4794943) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4794943 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C25H28N4O4/c1-18-23(24(27-33-18)19-5-3-2-4-6-19)25(30)26-21-8-7-20(28-9-13-31-14-10-28)17-22(21)29-11-15-32-16-12-29/h2-8,17H,9-16H2,1H3,(H,26,30) |
| InChIKey | XJKMZZYBWYHCIU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |