C20H24N4O3 — CID 24676967
N-(2,4-dimorpholin-4-ylphenyl)pyridine-3-carboxamide (PubChem CID 24676967) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)pyridine-3-carboxamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24676967 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1N1CCOCC1)c1cccnc1 |
| InChI | InChI=1S/C20H24N4O3/c25-20(16-2-1-5-21-15-16)22-18-4-3-17(23-6-10-26-11-7-23)14-19(18)24-8-12-27-13-9-24/h1-5,14-15H,6-13H2,(H,22,25) |
| InChIKey | JFUHNEZBTVCSNV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |