C22H31N5O3 — CID 112839574
1-tert-butyl-N-(2,4-dimorpholin-4-ylphenyl)pyrazole-4-carboxamide (PubChem CID 112839574) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-tert-butyl-N-(2,4-dimorpholin-4-ylphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-(2,4-dimorpholin-4-ylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 112839574 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-tert-butyl-N-(2,4-dimorpholin-4-ylphenyl)pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1cc(C(=O)Nc2ccc(N3CCOCC3)cc2N2CCOCC2)cn1 |
| InChI | InChI=1S/C22H31N5O3/c1-22(2,3)27-16-17(15-23-27)21(28)24-19-5-4-18(25-6-10-29-11-7-25)14-20(19)26-8-12-30-13-9-26/h4-5,14-16H,6-13H2,1-3H3,(H,24,28) |
| InChIKey | RHWRWYUJWWOXOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |