C19H27N3O3 — CID 112761839
N-(2,4-dimorpholin-4-ylphenyl)-2-methylcyclopropane-1-carboxamide (PubChem CID 112761839) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 112761839 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C19H27N3O3/c1-14-12-16(14)19(23)20-17-3-2-15(21-4-8-24-9-5-21)13-18(17)22-6-10-25-11-7-22/h2-3,13-14,16H,4-12H2,1H3,(H,20,23) |
| InChIKey | YLQWXLMFPQAGCR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |