C22H34N4O2S — CID 8654348
1-(2,4-dimorpholin-4-ylphenyl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8654348) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is 1-(2,4-dimorpholin-4-ylphenyl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(2,4-dimorpholin-4-ylphenyl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8654348 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-(2,4-dimorpholin-4-ylphenyl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C22H34N4O2S/c1-17-4-2-3-5-19(17)23-22(29)24-20-7-6-18(25-8-12-27-13-9-25)16-21(20)26-10-14-28-15-11-26/h6-7,16-17,19H,2-5,8-15H2,1H3,(H2,23,24,29)/t17-,19-/m1/s1 |
| InChIKey | FRLQQHLIHSJZAF-IEBWSBKVSA-N |
| XLogP | 3.22 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|