C18H25N3OS — CID 98606763
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(2-morpholin-4-ylphenyl)thiourea (PubChem CID 98606763) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(2-morpholin-4-ylphenyl)thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(2-morpholin-4-ylphenyl)thiourea |
|---|---|
| PubChem CID | 98606763 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(2-morpholin-4-ylphenyl)thiourea |
| SMILES | S=C(Nc1ccccc1N1CCOCC1)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H25N3OS/c23-18(20-16-12-13-5-6-14(16)11-13)19-15-3-1-2-4-17(15)21-7-9-22-10-8-21/h1-4,13-14,16H,5-12H2,(H2,19,20,23)/t13-,14-,16-/m0/s1 |
| InChIKey | PQQMHKKEPHXXHO-DZKIICNBSA-N |
| XLogP | 3.00 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|