C17H19N3S — CID 98684119
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-isoquinolin-5-ylthiourea (PubChem CID 98684119) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-isoquinolin-5-ylthiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-isoquinolin-5-ylthiourea |
|---|---|
| PubChem CID | 98684119 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-isoquinolin-5-ylthiourea |
| SMILES | S=C(Nc1cccc2cnccc12)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H19N3S/c21-17(20-16-9-11-4-5-12(16)8-11)19-15-3-1-2-13-10-18-7-6-14(13)15/h1-3,6-7,10-12,16H,4-5,8-9H2,(H2,19,20,21)/t11-,12-,16-/m0/s1 |
| InChIKey | DGFZRCSOVRKKQM-MKBNYLNASA-N |
| XLogP | 3.71 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|