C14H19N3S — CID 11920813
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 11920813) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 11920813 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N[C@@H]2C[C@H]3CC[C@@H]2C3)n1 |
| InChI | InChI=1S/C14H19N3S/c1-9-3-2-4-13(15-9)17-14(18)16-12-8-10-5-6-11(12)7-10/h2-4,10-12H,5-8H2,1H3,(H2,15,16,17,18)/t10-,11+,12+/m0/s1 |
| InChIKey | YXIHYTBMZSFDMY-QJPTWQEYSA-N |
| XLogP | 2.87 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|