C18H20N2OS — CID 11934685
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5-hydroxynaphthalen-1-yl)thiourea (PubChem CID 11934685) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5-hydroxynaphthalen-1-yl)thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5-hydroxynaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 11934685 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5-hydroxynaphthalen-1-yl)thiourea |
| SMILES | Oc1cccc2c(NC(=S)N[C@@H]3C[C@H]4CC[C@@H]3C4)cccc12 |
| InChI | InChI=1S/C18H20N2OS/c21-17-6-2-3-13-14(17)4-1-5-15(13)19-18(22)20-16-10-11-7-8-12(16)9-11/h1-6,11-12,16,21H,7-10H2,(H2,19,20,22)/t11-,12+,16+/m0/s1 |
| InChIKey | NWTJRMZDIJZYEF-HWWQOWPSSA-N |
| XLogP | 4.02 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|