C18H26N4O2S — CID 8654277
1-(2,4-dimorpholin-4-ylphenyl)-3-prop-2-enylthiourea (PubChem CID 8654277) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-(2,4-dimorpholin-4-ylphenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(2,4-dimorpholin-4-ylphenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 8654277 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-(2,4-dimorpholin-4-ylphenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C18H26N4O2S/c1-2-5-19-18(25)20-16-4-3-15(21-6-10-23-11-7-21)14-17(16)22-8-12-24-13-9-22/h2-4,14H,1,5-13H2,(H2,19,20,25) |
| InChIKey | JXXZHHBQEBYYEZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|