C18H19BrFN3OS — CID 100625305
1-(4-bromo-2-fluorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea (PubChem CID 100625305) has the molecular formula C18H19BrFN3OS and a molecular weight of 424.34 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100625305 |
| Molecular Formula | C18H19BrFN3OS |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea |
| SMILES | Fc1cc(Br)ccc1NC(=S)NCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H19BrFN3OS/c19-14-3-6-17(16(20)11-14)22-18(25)21-12-13-1-4-15(5-2-13)23-7-9-24-10-8-23/h1-6,11H,7-10,12H2,(H2,21,22,25) |
| InChIKey | SCPLUDPOKYSOIV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|