C17H18FN3OS — CID 8625478
1-(2-fluorophenyl)-3-(4-morpholin-4-ylphenyl)thiourea (PubChem CID 8625478) has the molecular formula C17H18FN3OS and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(4-morpholin-4-ylphenyl)thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-(4-morpholin-4-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8625478 |
| Molecular Formula | C17H18FN3OS |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(4-morpholin-4-ylphenyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H18FN3OS/c18-15-3-1-2-4-16(15)20-17(23)19-13-5-7-14(8-6-13)21-9-11-22-12-10-21/h1-8H,9-12H2,(H2,19,20,23) |
| InChIKey | MPLGPGRRZJBKSU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|