C19H17F4N3O3S — CID 17103891
2,3,5,6-tetrafluoro-4-methoxy-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide (PubChem CID 17103891) has the molecular formula C19H17F4N3O3S and a molecular weight of 443.42 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17103891 |
| Molecular Formula | C19H17F4N3O3S |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc(N3CCOCC3)cc2)c(F)c1F |
| InChI | InChI=1S/C19H17F4N3O3S/c1-28-17-15(22)13(20)12(14(21)16(17)23)18(27)25-19(30)24-10-2-4-11(5-3-10)26-6-8-29-9-7-26/h2-5H,6-9H2,1H3,(H2,24,25,27,30) |
| InChIKey | PODKZRLSILCLCZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|