C21H13ClF4N2O3S — CID 17114278
N-[[4-(4-chlorophenoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17114278) has the molecular formula C21H13ClF4N2O3S and a molecular weight of 484.86 g/mol. Its IUPAC name is N-[[4-(4-chlorophenoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[4-(4-chlorophenoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17114278 |
| Molecular Formula | C21H13ClF4N2O3S |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | N-[[4-(4-chlorophenoxy)phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc(Oc3ccc(Cl)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C21H13ClF4N2O3S/c1-30-19-17(25)15(23)14(16(24)18(19)26)20(29)28-21(32)27-11-4-8-13(9-5-11)31-12-6-2-10(22)3-7-12/h2-9H,1H3,(H2,27,28,29,32) |
| InChIKey | WJGZXCJYZLQYSY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|