C16H9ClF4N2O4S — CID 22780569
2-chloro-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]benzoic acid (PubChem CID 22780569) has the molecular formula C16H9ClF4N2O4S and a molecular weight of 436.77 g/mol. Its IUPAC name is 2-chloro-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 22780569 |
| Molecular Formula | C16H9ClF4N2O4S |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 2-chloro-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc(Cl)c(C(=O)O)c2)c(F)c1F |
| InChI | InChI=1S/C16H9ClF4N2O4S/c1-27-13-11(20)9(18)8(10(19)12(13)21)14(24)23-16(28)22-5-2-3-7(17)6(4-5)15(25)26/h2-4H,1H3,(H,25,26)(H2,22,23,24,28) |
| InChIKey | DEIZMVCRNPBUPB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|