C21H21F4N3O4S — CID 17115591
2,3,5,6-tetrafluoro-4-methoxy-N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 17115591) has the molecular formula C21H21F4N3O4S and a molecular weight of 487.48 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17115591 |
| Molecular Formula | C21H21F4N3O4S |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2c(F)c(F)c(OC)c(F)c2F)cc1OC |
| InChI | InChI=1S/C21H21F4N3O4S/c1-4-5-6-13(29)27-11-8-7-10(9-12(11)31-2)26-21(33)28-20(30)14-15(22)17(24)19(32-3)18(25)16(14)23/h7-9H,4-6H2,1-3H3,(H,27,29)(H2,26,28,30,33) |
| InChIKey | BTPYGYDGDKLIIE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|