C21H23N3O5S — CID 4028321
N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4028321) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4028321 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[[3-methoxy-4-(pentanoylamino)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C21H23N3O5S/c1-3-4-5-19(25)23-15-8-7-14(11-17(15)27-2)22-21(30)24-20(26)13-6-9-16-18(10-13)29-12-28-16/h6-11H,3-5,12H2,1-2H3,(H,23,25)(H2,22,24,26,30) |
| InChIKey | WYSLKWUJODZUTA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|