C23H30N2O4 — CID 2932391
4-butoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide (PubChem CID 2932391) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-butoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide.
| Compound Name | 4-butoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 2932391 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 4-butoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(NC(=O)CCCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-4-6-8-22(26)25-20-14-11-18(16-21(20)28-3)24-23(27)17-9-12-19(13-10-17)29-15-7-5-2/h9-14,16H,4-8,15H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | CMDFVLOFHMQMOV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|