C20H23BrN2O4 — CID 21215255
5-bromo-2-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide (PubChem CID 21215255) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 21215255 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 5-bromo-2-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=O)c2cc(Br)ccc2OC)cc1OC |
| InChI | InChI=1S/C20H23BrN2O4/c1-4-5-6-19(24)23-16-9-8-14(12-18(16)27-3)22-20(25)15-11-13(21)7-10-17(15)26-2/h7-12H,4-6H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | BUSABMBVSHEACQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |