C20H20F4N2O4 — CID 22778783
2,3,5,6-tetrafluoro-4-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide (PubChem CID 22778783) has the molecular formula C20H20F4N2O4 and a molecular weight of 428.38 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 22778783 |
| Molecular Formula | C20H20F4N2O4 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=O)c2c(F)c(F)c(OC)c(F)c2F)cc1OC |
| InChI | InChI=1S/C20H20F4N2O4/c1-4-5-6-13(27)26-11-8-7-10(9-12(11)29-2)25-20(28)14-15(21)17(23)19(30-3)18(24)16(14)22/h7-9H,4-6H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | FCJXEYUMYOVXKS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|