C18H15ClF4N2O3 — CID 2236520
N-[5-(butanoylamino)-2-chlorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 2236520) has the molecular formula C18H15ClF4N2O3 and a molecular weight of 418.77 g/mol. Its IUPAC name is N-[5-(butanoylamino)-2-chlorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[5-(butanoylamino)-2-chlorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 2236520 |
| Molecular Formula | C18H15ClF4N2O3 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[5-(butanoylamino)-2-chlorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)c2c(F)c(F)c(OC)c(F)c2F)c1 |
| InChI | InChI=1S/C18H15ClF4N2O3/c1-3-4-11(26)24-8-5-6-9(19)10(7-8)25-18(27)12-13(20)15(22)17(28-2)16(23)14(12)21/h5-7H,3-4H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | WIECOVXMCUVCQR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|