C22H28N2O6 — CID 2236592
3,4,5-trimethoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide (PubChem CID 2236592) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 2236592 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-methoxy-4-(pentanoylamino)phenyl]benzamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H28N2O6/c1-6-7-8-20(25)24-16-10-9-15(13-17(16)27-2)23-22(26)14-11-18(28-3)21(30-5)19(12-14)29-4/h9-13H,6-8H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | YILWXOUVEUDHQG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |