C17H19BrN2O4 — CID 2933388
5-bromo-N-[3-methoxy-4-(pentanoylamino)phenyl]furan-2-carboxamide (PubChem CID 2933388) has the molecular formula C17H19BrN2O4 and a molecular weight of 395.25 g/mol. Its IUPAC name is 5-bromo-N-[3-methoxy-4-(pentanoylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-methoxy-4-(pentanoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2933388 |
| Molecular Formula | C17H19BrN2O4 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-bromo-N-[3-methoxy-4-(pentanoylamino)phenyl]furan-2-carboxamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=O)c2ccc(Br)o2)cc1OC |
| InChI | InChI=1S/C17H19BrN2O4/c1-3-4-5-16(21)20-12-7-6-11(10-14(12)23-2)19-17(22)13-8-9-15(18)24-13/h6-10H,3-5H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | MASMPZHCRQUGDZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |