C19H20F2N2O4 — CID 131896646
N-[4-(butanoylamino)-3-methoxyphenyl]-2,4-difluoro-3-methoxybenzamide (PubChem CID 131896646) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[4-(butanoylamino)-3-methoxyphenyl]-2,4-difluoro-3-methoxybenzamide.
| Compound Name | N-[4-(butanoylamino)-3-methoxyphenyl]-2,4-difluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 131896646 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[4-(butanoylamino)-3-methoxyphenyl]-2,4-difluoro-3-methoxybenzamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)c2ccc(F)c(OC)c2F)cc1OC |
| InChI | InChI=1S/C19H20F2N2O4/c1-4-5-16(24)23-14-9-6-11(10-15(14)26-2)22-19(25)12-7-8-13(20)18(27-3)17(12)21/h6-10H,4-5H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | RDKPBRMFXJBLNV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |