C17H13F4N3O3S — CID 22776426
N-[(4-acetamidophenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 22776426) has the molecular formula C17H13F4N3O3S and a molecular weight of 415.37 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[(4-acetamidophenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 22776426 |
| Molecular Formula | C17H13F4N3O3S |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[(4-acetamidophenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc(NC(C)=O)cc2)c(F)c1F |
| InChI | InChI=1S/C17H13F4N3O3S/c1-7(25)22-8-3-5-9(6-4-8)23-17(28)24-16(26)10-11(18)13(20)15(27-2)14(21)12(10)19/h3-6H,1-2H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | AWVSHTQCNPNLPL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|