C21H12F5N5O2S — CID 17115212
2,3,5,6-tetrafluoro-N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-4-methoxybenzamide (PubChem CID 17115212) has the molecular formula C21H12F5N5O2S and a molecular weight of 493.42 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17115212 |
| Molecular Formula | C21H12F5N5O2S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc3nn(-c4ccc(F)cc4)nc3c2)c(F)c1F |
| InChI | InChI=1S/C21H12F5N5O2S/c1-33-19-17(25)15(23)14(16(24)18(19)26)20(32)28-21(34)27-10-4-7-12-13(8-10)30-31(29-12)11-5-2-9(22)3-6-11/h2-8H,1H3,(H2,27,28,32,34) |
| InChIKey | ASVLRAPHEASWNJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|