C21H14FN5O3S — CID 5138065
N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 5138065) has the molecular formula C21H14FN5O3S and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 5138065 |
| Molecular Formula | C21H14FN5O3S |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[[2-(4-fluorophenyl)benzotriazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2nn(-c3ccc(F)cc3)nc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H14FN5O3S/c22-13-2-5-15(6-3-13)27-25-16-7-4-14(10-17(16)26-27)23-21(31)24-20(28)12-1-8-18-19(9-12)30-11-29-18/h1-10H,11H2,(H2,23,24,28,31) |
| InChIKey | CGWKGSYXEMMVSS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|