C22H12ClF4N3O3S — CID 17114304
N-[[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17114304) has the molecular formula C22H12ClF4N3O3S and a molecular weight of 509.87 g/mol. Its IUPAC name is N-[[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17114304 |
| Molecular Formula | C22H12ClF4N3O3S |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | N-[[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2ccc3oc(-c4ccccc4Cl)nc3c2)c(F)c1F |
| InChI | InChI=1S/C22H12ClF4N3O3S/c1-32-19-17(26)15(24)14(16(25)18(19)27)20(31)30-22(34)28-9-6-7-13-12(8-9)29-21(33-13)10-4-2-3-5-11(10)23/h2-8H,1H3,(H2,28,30,31,34) |
| InChIKey | JGOUONSZRWIMJX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|