C22H13ClF4N2O3 — CID 17110986
N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17110986) has the molecular formula C22H13ClF4N2O3 and a molecular weight of 464.80 g/mol. Its IUPAC name is N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17110986 |
| Molecular Formula | C22H13ClF4N2O3 |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)Nc2ccc3oc(-c4ccc(C)cc4Cl)nc3c2)c(F)c1F |
| InChI | InChI=1S/C22H13ClF4N2O3/c1-9-3-5-11(12(23)7-9)22-29-13-8-10(4-6-14(13)32-22)28-21(30)15-16(24)18(26)20(31-2)19(27)17(15)25/h3-8H,1-2H3,(H,28,30) |
| InChIKey | VELKGULJYBYVAU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|