C15H9Cl3N2O3S — CID 4506898
2-chloro-5-[(2,3-dichlorobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 4506898) has the molecular formula C15H9Cl3N2O3S and a molecular weight of 403.67 g/mol. Its IUPAC name is 2-chloro-5-[(2,3-dichlorobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(2,3-dichlorobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4506898 |
| Molecular Formula | C15H9Cl3N2O3S |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 2-chloro-5-[(2,3-dichlorobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NC(=S)NC(=O)c2cccc(Cl)c2Cl)ccc1Cl |
| InChI | InChI=1S/C15H9Cl3N2O3S/c16-10-5-4-7(6-9(10)14(22)23)19-15(24)20-13(21)8-2-1-3-11(17)12(8)18/h1-6H,(H,22,23)(H2,19,20,21,24) |
| InChIKey | UPNMVTULLSYQLN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|