C28H30N4O6S — CID 57326208
3,4,5-trimethoxy-N-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]carbamothioyl]benzamide (PubChem CID 57326208) has the molecular formula C28H30N4O6S and a molecular weight of 550.64 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 57326208 |
| Molecular Formula | C28H30N4O6S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cccc(NC(=O)c3ccc(N4CCOCC4)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H30N4O6S/c1-35-23-15-19(16-24(36-2)25(23)37-3)27(34)31-28(39)30-21-6-4-5-20(17-21)29-26(33)18-7-9-22(10-8-18)32-11-13-38-14-12-32/h4-10,15-17H,11-14H2,1-3H3,(H,29,33)(H2,30,31,34,39) |
| InChIKey | PFMKEDBKQGJNML-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|