C22H25N3O5 — CID 55951801
4,6,7-trimethoxy-N-(3-morpholin-4-ylphenyl)-1H-indole-2-carboxamide (PubChem CID 55951801) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 4,6,7-trimethoxy-N-(3-morpholin-4-ylphenyl)-1H-indole-2-carboxamide.
| Compound Name | 4,6,7-trimethoxy-N-(3-morpholin-4-ylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55951801 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4,6,7-trimethoxy-N-(3-morpholin-4-ylphenyl)-1H-indole-2-carboxamide |
| SMILES | COc1cc(OC)c2cc(C(=O)Nc3cccc(N4CCOCC4)c3)[nH]c2c1OC |
| InChI | InChI=1S/C22H25N3O5/c1-27-18-13-19(28-2)21(29-3)20-16(18)12-17(24-20)22(26)23-14-5-4-6-15(11-14)25-7-9-30-10-8-25/h4-6,11-13,24H,7-10H2,1-3H3,(H,23,26) |
| InChIKey | HOMKIBAOKUQWOB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |