C19H22N2O4 — CID 26269457
2,3-dimethoxy-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 26269457) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 2,3-dimethoxy-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 26269457 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2,3-dimethoxy-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c1OC |
| InChI | InChI=1S/C19H22N2O4/c1-23-17-5-3-4-16(18(17)24-2)19(22)20-14-6-8-15(9-7-14)21-10-12-25-13-11-21/h3-9H,10-13H2,1-2H3,(H,20,22) |
| InChIKey | DESKWSMDHLNUJU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|