C22H28N2O5 — CID 90595853
2,3,4-trimethoxy-N-[4-(4-methoxypiperidin-1-yl)phenyl]benzamide (PubChem CID 90595853) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[4-(4-methoxypiperidin-1-yl)phenyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[4-(4-methoxypiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 90595853 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2,3,4-trimethoxy-N-[4-(4-methoxypiperidin-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCC(OC)CC3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C22H28N2O5/c1-26-17-11-13-24(14-12-17)16-7-5-15(6-8-16)23-22(25)18-9-10-19(27-2)21(29-4)20(18)28-3/h5-10,17H,11-14H2,1-4H3,(H,23,25) |
| InChIKey | STOZZQKRVCFTSG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|