C21H23N3O5 — CID 55847127
4,6,7-trimethoxy-N-[4-(propanoylamino)phenyl]-1H-indole-2-carboxamide (PubChem CID 55847127) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4,6,7-trimethoxy-N-[4-(propanoylamino)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6,7-trimethoxy-N-[4-(propanoylamino)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55847127 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4,6,7-trimethoxy-N-[4-(propanoylamino)phenyl]-1H-indole-2-carboxamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)c2cc3c(OC)cc(OC)c(OC)c3[nH]2)cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-5-18(25)22-12-6-8-13(9-7-12)23-21(26)15-10-14-16(27-2)11-17(28-3)20(29-4)19(14)24-15/h6-11,24H,5H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | XJKBPTNWOCIQER-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |