C20H22N2O4 — CID 39904436
4,6,7-trimethoxy-N-[(4-methylphenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 39904436) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4,6,7-trimethoxy-N-[(4-methylphenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6,7-trimethoxy-N-[(4-methylphenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39904436 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4,6,7-trimethoxy-N-[(4-methylphenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | COc1cc(OC)c2cc(C(=O)NCc3ccc(C)cc3)[nH]c2c1OC |
| InChI | InChI=1S/C20H22N2O4/c1-12-5-7-13(8-6-12)11-21-20(23)15-9-14-16(24-2)10-17(25-3)19(26-4)18(14)22-15/h5-10,22H,11H2,1-4H3,(H,21,23) |
| InChIKey | OVHMBEQTLJKFSX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |