C18H22N2O4 — CID 110181256
2-amino-3,4,5-trimethoxy-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 110181256) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-amino-3,4,5-trimethoxy-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 2-amino-3,4,5-trimethoxy-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 110181256 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-amino-3,4,5-trimethoxy-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(C)cc2)c(N)c(OC)c1OC |
| InChI | InChI=1S/C18H22N2O4/c1-11-5-7-12(8-6-11)10-20-18(21)13-9-14(22-2)16(23-3)17(24-4)15(13)19/h5-9H,10,19H2,1-4H3,(H,20,21) |
| InChIKey | VVZDVNAGGZXQHY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|