C12H18N2O4 — CID 18711859
2-amino-N-ethyl-3,4,5-trimethoxybenzamide (PubChem CID 18711859) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-N-ethyl-3,4,5-trimethoxybenzamide.
| Compound Name | 2-amino-N-ethyl-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 18711859 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-amino-N-ethyl-3,4,5-trimethoxybenzamide |
| SMILES | CCNC(=O)c1cc(OC)c(OC)c(OC)c1N |
| InChI | InChI=1S/C12H18N2O4/c1-5-14-12(15)7-6-8(16-2)10(17-3)11(18-4)9(7)13/h6H,5,13H2,1-4H3,(H,14,15) |
| InChIKey | TZQVIAKHHZNFMR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|